C15H19N3O2S — CID 143510397
(2S)-N-formyl-2-(methylamino)-2-[4-[(Z)-1-(methylideneamino)-2-sulfanylethenyl]phenyl]butanamide (PubChem CID 143510397) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is (2S)-N-formyl-2-(methylamino)-2-[4-[(Z)-1-(methylideneamino)-2-sulfanylethenyl]phenyl]butanamide.
| Compound Name | (2S)-N-formyl-2-(methylamino)-2-[4-[(Z)-1-(methylideneamino)-2-sulfanylethenyl]phenyl]butanamide |
|---|---|
| PubChem CID | 143510397 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | (2S)-N-formyl-2-(methylamino)-2-[4-[(Z)-1-(methylideneamino)-2-sulfanylethenyl]phenyl]butanamide |
| SMILES | C=N/C(=C\S)c1ccc([C@](CC)(NC)C(=O)NC=O)cc1 |
| InChI | InChI=1S/C15H19N3O2S/c1-4-15(17-3,14(20)18-10-19)12-7-5-11(6-8-12)13(9-21)16-2/h5-10,17,21H,2,4H2,1,3H3,(H,18,19,20)/b13-9-/t15-/m0/s1 |
| InChIKey | FQJCVTGLOLLERI-CTXBLAANSA-N |
| XLogP | 1.71 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|