C22H22N4O5 — CID 143510706
5-methoxy-2-[[methyl-[[(4S)-4-(5-methylfuro[3,2-b]pyridin-2-yl)-2,5-dioxoimidazolidin-4-yl]methyl]amino]methyl]benzaldehyde (PubChem CID 143510706) has the molecular formula C22H22N4O5 and a molecular weight of 422.44 g/mol. Its IUPAC name is 5-methoxy-2-[[methyl-[[(4S)-4-(5-methylfuro[3,2-b]pyridin-2-yl)-2,5-dioxoimidazolidin-4-yl]methyl]amino]methyl]benzaldehyde.
| Compound Name | 5-methoxy-2-[[methyl-[[(4S)-4-(5-methylfuro[3,2-b]pyridin-2-yl)-2,5-dioxoimidazolidin-4-yl]methyl]amino]methyl]benzaldehyde |
|---|---|
| PubChem CID | 143510706 |
| Molecular Formula | C22H22N4O5 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 5-methoxy-2-[[methyl-[[(4S)-4-(5-methylfuro[3,2-b]pyridin-2-yl)-2,5-dioxoimidazolidin-4-yl]methyl]amino]methyl]benzaldehyde |
| SMILES | COc1ccc(CN(C)C[C@@]2(c3cc4nc(C)ccc4o3)NC(=O)NC2=O)c(C=O)c1 |
| InChI | InChI=1S/C22H22N4O5/c1-13-4-7-18-17(23-13)9-19(31-18)22(20(28)24-21(29)25-22)12-26(2)10-14-5-6-16(30-3)8-15(14)11-27/h4-9,11H,10,12H2,1-3H3,(H2,24,25,28,29)/t22-/m0/s1 |
| InChIKey | CUFMYFLFMHAVCL-QFIPXVFZSA-N |
| XLogP | 2.12 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|