C19H19N3O5 — CID 143510183
2-[[[(4R)-4-(4-hydroxyphenyl)-2,5-dioxoimidazolidin-4-yl]methylamino]methyl]-5-methoxybenzaldehyde (PubChem CID 143510183) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is 2-[[[(4R)-4-(4-hydroxyphenyl)-2,5-dioxoimidazolidin-4-yl]methylamino]methyl]-5-methoxybenzaldehyde.
| Compound Name | 2-[[[(4R)-4-(4-hydroxyphenyl)-2,5-dioxoimidazolidin-4-yl]methylamino]methyl]-5-methoxybenzaldehyde |
|---|---|
| PubChem CID | 143510183 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 2-[[[(4R)-4-(4-hydroxyphenyl)-2,5-dioxoimidazolidin-4-yl]methylamino]methyl]-5-methoxybenzaldehyde |
| SMILES | COc1ccc(CNC[C@@]2(c3ccc(O)cc3)NC(=O)NC2=O)c(C=O)c1 |
| InChI | InChI=1S/C19H19N3O5/c1-27-16-7-2-12(13(8-16)10-23)9-20-11-19(17(25)21-18(26)22-19)14-3-5-15(24)6-4-14/h2-8,10,20,24H,9,11H2,1H3,(H2,21,22,25,26)/t19-/m0/s1 |
| InChIKey | OQADRPQIEXIFKL-IBGZPJMESA-N |
| XLogP | 1.04 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|