C22H24N4O4S — CID 143512597
(E)-5-[(4R)-4-[[(2-formyl-4-methoxyphenyl)methylamino]methyl]-2-methylidene-5-oxoimidazolidin-4-yl]-2-[(Z)-prop-1-enyl]sulfanylpent-2-en-4-ynamide (PubChem CID 143512597) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is (E)-5-[(4R)-4-[[(2-formyl-4-methoxyphenyl)methylamino]methyl]-2-methylidene-5-oxoimidazolidin-4-yl]-2-[(Z)-prop-1-enyl]sulfanylpent-2-en-4-ynamide.
| Compound Name | (E)-5-[(4R)-4-[[(2-formyl-4-methoxyphenyl)methylamino]methyl]-2-methylidene-5-oxoimidazolidin-4-yl]-2-[(Z)-prop-1-enyl]sulfanylpent-2-en-4-ynamide |
|---|---|
| PubChem CID | 143512597 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | (E)-5-[(4R)-4-[[(2-formyl-4-methoxyphenyl)methylamino]methyl]-2-methylidene-5-oxoimidazolidin-4-yl]-2-[(Z)-prop-1-enyl]sulfanylpent-2-en-4-ynamide |
| SMILES | C=C1NC(=O)[C@@](C#C/C=C(/S/C=C\C)C(N)=O)(CNCc2ccc(OC)cc2C=O)N1 |
| InChI | InChI=1S/C22H24N4O4S/c1-4-10-31-19(20(23)28)6-5-9-22(21(29)25-15(2)26-22)14-24-12-16-7-8-18(30-3)11-17(16)13-27/h4,6-8,10-11,13,24,26H,2,12,14H2,1,3H3,(H2,23,28)(H,25,29)/b10-4-,19-6+/t22-/m1/s1 |
| InChIKey | NFHAJOLPMSGTOJ-IGAQQFFQSA-N |
| XLogP | 1.17 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|