C26H34N2O4 — CID 143510343
2-ethyl-4-methoxy-1-prop-1-en-2-ylbenzene;5-ethyl-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione (PubChem CID 143510343) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is 2-ethyl-4-methoxy-1-prop-1-en-2-ylbenzene;5-ethyl-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione.
| Compound Name | 2-ethyl-4-methoxy-1-prop-1-en-2-ylbenzene;5-ethyl-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143510343 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 2-ethyl-4-methoxy-1-prop-1-en-2-ylbenzene;5-ethyl-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione |
| SMILES | C=C(C)c1ccc(OC)cc1CC.CCC1(c2ccc(OC(C)C)cc2)NC(=O)NC1=O |
| InChI | InChI=1S/C14H18N2O3.C12H16O/c1-4-14(12(17)15-13(18)16-14)10-5-7-11(8-6-10)19-9(2)3;1-5-10-8-11(13-4)6-7-12(10)9(2)3/h5-9H,4H2,1-3H3,(H2,15,16,17,18);6-8H,2,5H2,1,3-4H3 |
| InChIKey | NKDNGTRQUJKLNZ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|