C23H29N3O5 — CID 89190924
N-[[(4R)-2,5-dioxo-4-(4-propan-2-yloxyphenyl)imidazolidin-4-yl]methyl]-N-[(3Z,5E)-5-methoxy-2-methylidenehepta-3,5-dienyl]formamide (PubChem CID 89190924) has the molecular formula C23H29N3O5 and a molecular weight of 427.50 g/mol. Its IUPAC name is N-[[(4R)-2,5-dioxo-4-(4-propan-2-yloxyphenyl)imidazolidin-4-yl]methyl]-N-[(3Z,5E)-5-methoxy-2-methylidenehepta-3,5-dienyl]formamide.
| Compound Name | N-[[(4R)-2,5-dioxo-4-(4-propan-2-yloxyphenyl)imidazolidin-4-yl]methyl]-N-[(3Z,5E)-5-methoxy-2-methylidenehepta-3,5-dienyl]formamide |
|---|---|
| PubChem CID | 89190924 |
| Molecular Formula | C23H29N3O5 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | N-[[(4R)-2,5-dioxo-4-(4-propan-2-yloxyphenyl)imidazolidin-4-yl]methyl]-N-[(3Z,5E)-5-methoxy-2-methylidenehepta-3,5-dienyl]formamide |
| SMILES | C=C(/C=C\C(=C/C)OC)CN(C=O)C[C@@]1(c2ccc(OC(C)C)cc2)NC(=O)NC1=O |
| InChI | InChI=1S/C23H29N3O5/c1-6-19(30-5)10-7-17(4)13-26(15-27)14-23(21(28)24-22(29)25-23)18-8-11-20(12-9-18)31-16(2)3/h6-12,15-16H,4,13-14H2,1-3,5H3,(H2,24,25,28,29)/b10-7-,19-6+/t23-/m0/s1 |
| InChIKey | LJFHZVWGQVVMRN-KGKZBQAXSA-N |
| XLogP | 2.63 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|