C23H23FN4O4S — CID 88973941
N-[[(4R)-4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,5-dioxoimidazolidin-4-yl]methyl]-N-[(3Z,5E)-5-methoxy-2-methylidenehepta-3,5-dienyl]formamide (PubChem CID 88973941) has the molecular formula C23H23FN4O4S and a molecular weight of 470.53 g/mol. Its IUPAC name is N-[[(4R)-4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,5-dioxoimidazolidin-4-yl]methyl]-N-[(3Z,5E)-5-methoxy-2-methylidenehepta-3,5-dienyl]formamide.
| Compound Name | N-[[(4R)-4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,5-dioxoimidazolidin-4-yl]methyl]-N-[(3Z,5E)-5-methoxy-2-methylidenehepta-3,5-dienyl]formamide |
|---|---|
| PubChem CID | 88973941 |
| Molecular Formula | C23H23FN4O4S |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | N-[[(4R)-4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,5-dioxoimidazolidin-4-yl]methyl]-N-[(3Z,5E)-5-methoxy-2-methylidenehepta-3,5-dienyl]formamide |
| SMILES | C=C(/C=C\C(=C/C)OC)CN(C=O)C[C@@]1(c2nc(-c3ccc(F)cc3)cs2)NC(=O)NC1=O |
| InChI | InChI=1S/C23H23FN4O4S/c1-4-18(32-3)10-5-15(2)11-28(14-29)13-23(20(30)26-22(31)27-23)21-25-19(12-33-21)16-6-8-17(24)9-7-16/h4-10,12,14H,2,11,13H2,1,3H3,(H2,26,27,30,31)/b10-5-,18-4+/t23-/m1/s1 |
| InChIKey | KTGBUQRMKHXKTM-UCNHSRLRSA-N |
| XLogP | 3.10 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|