C11H11Br2N5O2 — CID 14351174
3-amino-13,14-dibromo-5-hydroxy-2,4,9,15-tetrazatetracyclo[7.6.0.01,5.011,15]pentadeca-2,11,13-trien-10-one (PubChem CID 14351174) has the molecular formula C11H11Br2N5O2 and a molecular weight of 405.05 g/mol. Its IUPAC name is 3-amino-13,14-dibromo-5-hydroxy-2,4,9,15-tetrazatetracyclo[7.6.0.01,5.011,15]pentadeca-2,11,13-trien-10-one.
| Compound Name | 3-amino-13,14-dibromo-5-hydroxy-2,4,9,15-tetrazatetracyclo[7.6.0.01,5.011,15]pentadeca-2,11,13-trien-10-one |
|---|---|
| PubChem CID | 14351174 |
| Molecular Formula | C11H11Br2N5O2 |
| Molecular Weight | 405.05 g/mol |
| Exact Mass | 402.93 |
| IUPAC Name | 3-amino-13,14-dibromo-5-hydroxy-2,4,9,15-tetrazatetracyclo[7.6.0.01,5.011,15]pentadeca-2,11,13-trien-10-one |
| SMILES | NC1=NC23N(CCCC2(O)N1)C(=O)c1cc(Br)c(Br)n13 |
| InChI | InChI=1S/C11H11Br2N5O2/c12-5-4-6-8(19)17-3-1-2-10(20)11(17,16-9(14)15-10)18(6)7(5)13/h4,20H,1-3H2,(H3,14,15,16) |
| InChIKey | LERJEFMIFQBNIN-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 95.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.05 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |