C12H14Cl2N2O2 — CID 162361619
4,6-dichloro-2-(2,2-dimethylpyrrolidin-1-yl)pyridine-3-carboxylic acid (PubChem CID 162361619) has the molecular formula C12H14Cl2N2O2 and a molecular weight of 289.16 g/mol. Its IUPAC name is 4,6-dichloro-2-(2,2-dimethylpyrrolidin-1-yl)pyridine-3-carboxylic acid.
| Compound Name | 4,6-dichloro-2-(2,2-dimethylpyrrolidin-1-yl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 162361619 |
| Molecular Formula | C12H14Cl2N2O2 |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 4,6-dichloro-2-(2,2-dimethylpyrrolidin-1-yl)pyridine-3-carboxylic acid |
| SMILES | CC1(C)CCCN1c1nc(Cl)cc(Cl)c1C(=O)O |
| InChI | InChI=1S/C12H14Cl2N2O2/c1-12(2)4-3-5-16(12)10-9(11(17)18)7(13)6-8(14)15-10/h6H,3-5H2,1-2H3,(H,17,18) |
| InChIKey | QCLBLCVMKCLWPZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|