C18H28BClN2O2 — CID 169256792
3-chloro-2-(2,2-dimethylpyrrolidin-1-yl)-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 169256792) has the molecular formula C18H28BClN2O2 and a molecular weight of 350.70 g/mol. Its IUPAC name is 3-chloro-2-(2,2-dimethylpyrrolidin-1-yl)-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 3-chloro-2-(2,2-dimethylpyrrolidin-1-yl)-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 169256792 |
| Molecular Formula | C18H28BClN2O2 |
| Molecular Weight | 350.70 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 3-chloro-2-(2,2-dimethylpyrrolidin-1-yl)-6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | Cc1nc(N2CCCC2(C)C)c(Cl)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H28BClN2O2/c1-12-13(19-23-17(4,5)18(6,7)24-19)11-14(20)15(21-12)22-10-8-9-16(22,2)3/h11H,8-10H2,1-7H3 |
| InChIKey | UZBFAEXOZMUMQN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.70 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|