C10H10Cl2N2O2 — CID 162361663
4,6-dichloro-2-pyrrolidin-1-ylpyridine-3-carboxylic acid (PubChem CID 162361663) has the molecular formula C10H10Cl2N2O2 and a molecular weight of 261.11 g/mol. Its IUPAC name is 4,6-dichloro-2-pyrrolidin-1-ylpyridine-3-carboxylic acid.
| Compound Name | 4,6-dichloro-2-pyrrolidin-1-ylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 162361663 |
| Molecular Formula | C10H10Cl2N2O2 |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | 4,6-dichloro-2-pyrrolidin-1-ylpyridine-3-carboxylic acid |
| SMILES | O=C(O)c1c(Cl)cc(Cl)nc1N1CCCC1 |
| InChI | InChI=1S/C10H10Cl2N2O2/c11-6-5-7(12)13-9(8(6)10(15)16)14-3-1-2-4-14/h5H,1-4H2,(H,15,16) |
| InChIKey | HECHNIHYGSLHBF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|