C12H13Br2N5O3 — CID 46176623
(1R,5S)-3-amino-7,8-dibromo-2,4,9,12-tetrazatetracyclo[10.3.0.01,5.06,10]pentadeca-3,6(10),7-trien-11-one;formic acid (PubChem CID 46176623) has the molecular formula C12H13Br2N5O3 and a molecular weight of 435.08 g/mol. Its IUPAC name is (1R,5S)-3-amino-7,8-dibromo-2,4,9,12-tetrazatetracyclo[10.3.0.01,5.06,10]pentadeca-3,6(10),7-trien-11-one;formic acid.
| Compound Name | (1R,5S)-3-amino-7,8-dibromo-2,4,9,12-tetrazatetracyclo[10.3.0.01,5.06,10]pentadeca-3,6(10),7-trien-11-one;formic acid |
|---|---|
| PubChem CID | 46176623 |
| Molecular Formula | C12H13Br2N5O3 |
| Molecular Weight | 435.08 g/mol |
| Exact Mass | 432.94 |
| IUPAC Name | (1R,5S)-3-amino-7,8-dibromo-2,4,9,12-tetrazatetracyclo[10.3.0.01,5.06,10]pentadeca-3,6(10),7-trien-11-one;formic acid |
| SMILES | NC1=N[C@H]2c3c([nH]c(Br)c3Br)C(=O)N3CCC[C@]23N1.O=CO |
| InChI | InChI=1S/C11H11Br2N5O.CH2O2/c12-5-4-6(15-8(5)13)9(19)18-3-1-2-11(18)7(4)16-10(14)17-11;2-1-3/h7,15H,1-3H2,(H3,14,16,17);1H,(H,2,3)/t7-,11+;/m0./s1 |
| InChIKey | YOBRCFADGDZYMJ-VNYQHEISSA-N |
| XLogP | 1.15 |
| TPSA | 123.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.08 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|