C9H16N6O — CID 176529985
[(3aS)-2-amino-6-imino-3a,4,5,8,9,10-hexahydro-1H-pyrrolo[1,2-c]purin-4-yl]methanol (PubChem CID 176529985) has the molecular formula C9H16N6O and a molecular weight of 224.27 g/mol. Its IUPAC name is [(3aS)-2-amino-6-imino-3a,4,5,8,9,10-hexahydro-1H-pyrrolo[1,2-c]purin-4-yl]methanol.
| Compound Name | [(3aS)-2-amino-6-imino-3a,4,5,8,9,10-hexahydro-1H-pyrrolo[1,2-c]purin-4-yl]methanol |
|---|---|
| PubChem CID | 176529985 |
| Molecular Formula | C9H16N6O |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | [(3aS)-2-amino-6-imino-3a,4,5,8,9,10-hexahydro-1H-pyrrolo[1,2-c]purin-4-yl]methanol |
| SMILES | [H]/N=C1\NC(CO)[C@@H]2N=C(N)NC23CCCN13 |
| InChI | InChI=1S/C9H16N6O/c10-7-13-6-5(4-16)12-8(11)15-3-1-2-9(6,15)14-7/h5-6,16H,1-4H2,(H2,11,12)(H3,10,13,14)/t5?,6-,9?/m0/s1 |
| InChIKey | JFYZIJPKLXIKLJ-KJXBMWQCSA-N |
| XLogP | -2.04 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|