C9H17N6O4+ — CID 136846911
(3aS,4R,10aS)-2,6-diamino-5-hydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-7-ium-10,10-diol (PubChem CID 136846911) has the molecular formula C9H17N6O4+ and a molecular weight of 273.27 g/mol. Its IUPAC name is (3aS,4R,10aS)-2,6-diamino-5-hydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-7-ium-10,10-diol.
| Compound Name | (3aS,4R,10aS)-2,6-diamino-5-hydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-7-ium-10,10-diol |
|---|---|
| PubChem CID | 136846911 |
| Molecular Formula | C9H17N6O4+ |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | (3aS,4R,10aS)-2,6-diamino-5-hydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-7-ium-10,10-diol |
| SMILES | NC1=N[C@H]2[C@H](CO)N(O)C(N)=[N+]3CCC(O)(O)[C@]23N1 |
| InChI | InChI=1S/C9H16N6O4/c10-6-12-5-4(3-16)15(19)7(11)14-2-1-8(17,18)9(5,14)13-6/h4-5,11,16-19H,1-3H2,(H3,10,12,13)/p+1/t4-,5-,9-/m0/s1 |
| InChIKey | KUMXVBFFVVLQFX-PJPYAQQDSA-O |
| XLogP | -4.55 |
| TPSA | 163.60 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | -4.55 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|