C9H18N6O8S — CID 100990933
[(3aS,4R,9R,10aS)-2,6-diamino-5,10,10-trihydroxy-4-(hydroxymethyl)-1,3a,4,6,8,9-hexahydropyrrolo[1,2-c]purin-9-yl] hydrogen sulfate (PubChem CID 100990933) has the molecular formula C9H18N6O8S and a molecular weight of 370.34 g/mol. Its IUPAC name is [(3aS,4R,9R,10aS)-2,6-diamino-5,10,10-trihydroxy-4-(hydroxymethyl)-1,3a,4,6,8,9-hexahydropyrrolo[1,2-c]purin-9-yl] hydrogen sulfate.
| Compound Name | [(3aS,4R,9R,10aS)-2,6-diamino-5,10,10-trihydroxy-4-(hydroxymethyl)-1,3a,4,6,8,9-hexahydropyrrolo[1,2-c]purin-9-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 100990933 |
| Molecular Formula | C9H18N6O8S |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | [(3aS,4R,9R,10aS)-2,6-diamino-5,10,10-trihydroxy-4-(hydroxymethyl)-1,3a,4,6,8,9-hexahydropyrrolo[1,2-c]purin-9-yl] hydrogen sulfate |
| SMILES | NC1=N[C@H]2[C@H](CO)N(O)C(N)N3C[C@@H](OS(=O)(=O)O)C(O)(O)[C@]23N1 |
| InChI | InChI=1S/C9H18N6O8S/c10-6-12-5-3(2-16)15(19)7(11)14-1-4(23-24(20,21)22)9(17,18)8(5,14)13-6/h3-5,7,16-19H,1-2,11H2,(H3,10,12,13)(H,20,21,22)/t3-,4+,5-,7?,8-/m0/s1 |
| InChIKey | CODNYINZGUUWKF-SWLQZBMDSA-N |
| XLogP | -5.54 |
| TPSA | 227.43 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | -5.54 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|