C9H15N6O8S- — CID 132583453
[(3aS,4R,9R,10aS)-2-amino-5,10,10-trihydroxy-4-(hydroxymethyl)-6-imino-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] sulfate (PubChem CID 132583453) has the molecular formula C9H15N6O8S- and a molecular weight of 367.32 g/mol. Its IUPAC name is [(3aS,4R,9R,10aS)-2-amino-5,10,10-trihydroxy-4-(hydroxymethyl)-6-imino-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] sulfate.
| Compound Name | [(3aS,4R,9R,10aS)-2-amino-5,10,10-trihydroxy-4-(hydroxymethyl)-6-imino-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] sulfate |
|---|---|
| PubChem CID | 132583453 |
| Molecular Formula | C9H15N6O8S- |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | [(3aS,4R,9R,10aS)-2-amino-5,10,10-trihydroxy-4-(hydroxymethyl)-6-imino-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] sulfate |
| SMILES | [H]/N=C1\N(O)[C@@H](CO)[C@@H]2N=C(N)N[C@]23N1C[C@@H](OS(=O)(=O)[O-])C3(O)O |
| InChI | InChI=1S/C9H16N6O8S/c10-6-12-5-3(2-16)15(19)7(11)14-1-4(23-24(20,21)22)9(17,18)8(5,14)13-6/h3-5,11,16-19H,1-2H2,(H3,10,12,13)(H,20,21,22)/p-1/b11-7-/t3-,4+,5-,8-/m0/s1 |
| InChIKey | AXKNFGCPJPRVCA-CKMNZBBGSA-M |
| XLogP | -5.19 |
| TPSA | 228.09 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | -5.19 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|