C14H24N7O4+ — CID 140712530
[(3aS,4R,10aS)-2,6-diamino-10,10-dihydroxy-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purin-7-ium-4-yl]methyl pyrrolidine-1-carboxylate (PubChem CID 140712530) has the molecular formula C14H24N7O4+ and a molecular weight of 354.39 g/mol. Its IUPAC name is [(3aS,4R,10aS)-2,6-diamino-10,10-dihydroxy-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purin-7-ium-4-yl]methyl pyrrolidine-1-carboxylate.
| Compound Name | [(3aS,4R,10aS)-2,6-diamino-10,10-dihydroxy-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purin-7-ium-4-yl]methyl pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 140712530 |
| Molecular Formula | C14H24N7O4+ |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | [(3aS,4R,10aS)-2,6-diamino-10,10-dihydroxy-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purin-7-ium-4-yl]methyl pyrrolidine-1-carboxylate |
| SMILES | NC1=N[C@H]2[C@H](COC(=O)N3CCCC3)NC(N)=[N+]3CCC(O)(O)[C@]23N1 |
| InChI | InChI=1S/C14H23N7O4/c15-10-18-9-8(7-25-12(22)20-4-1-2-5-20)17-11(16)21-6-3-13(23,24)14(9,21)19-10/h8-9,23-24H,1-7H2,(H5,15,16,17,18,19)/p+1/t8-,9-,14-/m0/s1 |
| InChIKey | UACJHWITUVJODY-FZNYLWTLSA-O |
| XLogP | -3.41 |
| TPSA | 161.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | -3.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|