C20H24N8O6+2 — CID 58611742
(2,6-diamino-10,10-dihydroxy-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purine-3,7-diium-4-yl)methyl N-[4-(2,5-dioxopyrrol-1-yl)phenyl]carbamate (PubChem CID 58611742) has the molecular formula C20H24N8O6+2 and a molecular weight of 472.46 g/mol. Its IUPAC name is (2,6-diamino-10,10-dihydroxy-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purine-3,7-diium-4-yl)methyl N-[4-(2,5-dioxopyrrol-1-yl)phenyl]carbamate.
| Compound Name | (2,6-diamino-10,10-dihydroxy-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purine-3,7-diium-4-yl)methyl N-[4-(2,5-dioxopyrrol-1-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 58611742 |
| Molecular Formula | C20H24N8O6+2 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | (2,6-diamino-10,10-dihydroxy-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purine-3,7-diium-4-yl)methyl N-[4-(2,5-dioxopyrrol-1-yl)phenyl]carbamate |
| SMILES | NC1=[NH+]C2C(COC(=O)Nc3ccc(N4C(=O)C=CC4=O)cc3)NC(N)=[N+]3CCC(O)(O)C23N1 |
| InChI | InChI=1S/C20H22N8O6/c21-16-25-15-12(24-17(22)27-8-7-19(32,33)20(15,27)26-16)9-34-18(31)23-10-1-3-11(4-2-10)28-13(29)5-6-14(28)30/h1-6,12,15,32-33H,7-9H2,(H6,21,22,23,24,25,26,31)/p+2 |
| InChIKey | FYGFUCRMFPSKLC-UHFFFAOYSA-P |
| XLogP | -4.89 |
| TPSA | 209.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | -4.89 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|