C20H22N2O4 — CID 76563578
(1-methylcyclooct-4-en-1-yl) N-[4-(2,5-dioxopyrrol-1-yl)phenyl]carbamate (PubChem CID 76563578) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is (1-methylcyclooct-4-en-1-yl) N-[4-(2,5-dioxopyrrol-1-yl)phenyl]carbamate.
| Compound Name | (1-methylcyclooct-4-en-1-yl) N-[4-(2,5-dioxopyrrol-1-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 76563578 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (1-methylcyclooct-4-en-1-yl) N-[4-(2,5-dioxopyrrol-1-yl)phenyl]carbamate |
| SMILES | CC1(OC(=O)Nc2ccc(N3C(=O)C=CC3=O)cc2)CCC=CCCC1 |
| InChI | InChI=1S/C20H22N2O4/c1-20(13-5-3-2-4-6-14-20)26-19(25)21-15-7-9-16(10-8-15)22-17(23)11-12-18(22)24/h2-3,7-12H,4-6,13-14H2,1H3,(H,21,25) |
| InChIKey | ZRKKTIZKHHHLLN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|