C19H20N2O4 — CID 90711784
[(1S)-cyclooct-4-en-1-yl] N-[4-(2,5-dioxopyrrol-1-yl)phenyl]carbamate (PubChem CID 90711784) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is [(1S)-cyclooct-4-en-1-yl] N-[4-(2,5-dioxopyrrol-1-yl)phenyl]carbamate.
| Compound Name | [(1S)-cyclooct-4-en-1-yl] N-[4-(2,5-dioxopyrrol-1-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 90711784 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | [(1S)-cyclooct-4-en-1-yl] N-[4-(2,5-dioxopyrrol-1-yl)phenyl]carbamate |
| SMILES | O=C(Nc1ccc(N2C(=O)C=CC2=O)cc1)O[C@@H]1CCC=CCCC1 |
| InChI | InChI=1S/C19H20N2O4/c22-17-12-13-18(23)21(17)15-10-8-14(9-11-15)20-19(24)25-16-6-4-2-1-3-5-7-16/h1-2,8-13,16H,3-7H2,(H,20,24)/t16-/m1/s1 |
| InChIKey | ICKCMAUZFBAEHX-MRXNPFEDSA-N |
| XLogP | 3.55 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|