C11H21N6O4+ — CID 140770045
(3aS,4R,9S,10aS)-2,6-diamino-9-ethoxy-4-(hydroxymethyl)-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purin-7-ium-10,10-diol (PubChem CID 140770045) has the molecular formula C11H21N6O4+ and a molecular weight of 301.33 g/mol. Its IUPAC name is (3aS,4R,9S,10aS)-2,6-diamino-9-ethoxy-4-(hydroxymethyl)-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purin-7-ium-10,10-diol.
| Compound Name | (3aS,4R,9S,10aS)-2,6-diamino-9-ethoxy-4-(hydroxymethyl)-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purin-7-ium-10,10-diol |
|---|---|
| PubChem CID | 140770045 |
| Molecular Formula | C11H21N6O4+ |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | (3aS,4R,9S,10aS)-2,6-diamino-9-ethoxy-4-(hydroxymethyl)-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purin-7-ium-10,10-diol |
| SMILES | CCO[C@H]1C[N+]2=C(N)N[C@@H](CO)[C@@H]3N=C(N)N[C@@]32C1(O)O |
| InChI | InChI=1S/C11H20N6O4/c1-2-21-6-3-17-9(13)14-5(4-18)7-10(17,11(6,19)20)16-8(12)15-7/h5-7,18-20H,2-4H2,1H3,(H5,12,13,14,15,16)/p+1/t5-,6-,7-,10-/m0/s1 |
| InChIKey | JTTJJCDKBIQVHT-QFNGTQGLSA-O |
| XLogP | -4.64 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | -4.64 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|