C13H24N7O5+ — CID 140712549
[(3aS,4R,8S,9S,10aS)-2,6-diamino-9,10,10-trihydroxy-8-propyl-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purin-7-ium-4-yl]methyl carbamate (PubChem CID 140712549) has the molecular formula C13H24N7O5+ and a molecular weight of 358.38 g/mol. Its IUPAC name is [(3aS,4R,8S,9S,10aS)-2,6-diamino-9,10,10-trihydroxy-8-propyl-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purin-7-ium-4-yl]methyl carbamate.
| Compound Name | [(3aS,4R,8S,9S,10aS)-2,6-diamino-9,10,10-trihydroxy-8-propyl-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purin-7-ium-4-yl]methyl carbamate |
|---|---|
| PubChem CID | 140712549 |
| Molecular Formula | C13H24N7O5+ |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | [(3aS,4R,8S,9S,10aS)-2,6-diamino-9,10,10-trihydroxy-8-propyl-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purin-7-ium-4-yl]methyl carbamate |
| SMILES | CCC[C@H]1[C@H](O)C(O)(O)[C@]23NC(N)=N[C@H]2[C@H](COC(N)=O)NC(N)=[N+]13 |
| InChI | InChI=1S/C13H23N7O5/c1-2-3-6-8(21)13(23,24)12-7(18-9(14)19-12)5(4-25-11(16)22)17-10(15)20(6)12/h5-8,21,23-24H,2-4H2,1H3,(H7,14,15,16,17,18,19,22)/p+1/t5-,6-,7-,8-,12-/m0/s1 |
| InChIKey | WUZFBOSBPPJFMY-GZWFRWMJSA-O |
| XLogP | -4.41 |
| TPSA | 204.48 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | -4.41 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|