C11H20N6O5+2 — CID 146677046
[(5S,6R,11S)-3,8-diamino-11,12,12-trihydroxy-2-aza-4,7-diazoniatricyclo[7.3.0.01,5]dodeca-3,7-dien-6-yl]methyl carbamate (PubChem CID 146677046) has the molecular formula C11H20N6O5+2 and a molecular weight of 316.32 g/mol. Its IUPAC name is [(5S,6R,11S)-3,8-diamino-11,12,12-trihydroxy-2-aza-4,7-diazoniatricyclo[7.3.0.01,5]dodeca-3,7-dien-6-yl]methyl carbamate.
| Compound Name | [(5S,6R,11S)-3,8-diamino-11,12,12-trihydroxy-2-aza-4,7-diazoniatricyclo[7.3.0.01,5]dodeca-3,7-dien-6-yl]methyl carbamate |
|---|---|
| PubChem CID | 146677046 |
| Molecular Formula | C11H20N6O5+2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | [(5S,6R,11S)-3,8-diamino-11,12,12-trihydroxy-2-aza-4,7-diazoniatricyclo[7.3.0.01,5]dodeca-3,7-dien-6-yl]methyl carbamate |
| SMILES | NC(=O)OC[C@@H]1[NH+]=C(N)C2C[C@H](O)C(O)(O)C23NC(N)=[NH+][C@@H]13 |
| InChI | InChI=1S/C11H18N6O5/c12-7-3-1-5(18)11(20,21)10(3)6(16-8(13)17-10)4(15-7)2-22-9(14)19/h3-6,18,20-21H,1-2H2,(H2,12,15)(H2,14,19)(H3,13,16,17)/p+2/t3?,4-,5-,6-,10?/m0/s1 |
| InChIKey | APHGSNGULAACTG-NQOOYXETSA-P |
| XLogP | -7.93 |
| TPSA | 205.02 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | -7.93 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|