C5H7Cl2NO2 — CID 141209953
(2,2-dichlorocyclopropyl)methyl carbamate (PubChem CID 141209953) has the molecular formula C5H7Cl2NO2 and a molecular weight of 184.02 g/mol. Its IUPAC name is (2,2-dichlorocyclopropyl)methyl carbamate.
| Compound Name | (2,2-dichlorocyclopropyl)methyl carbamate |
|---|---|
| PubChem CID | 141209953 |
| Molecular Formula | C5H7Cl2NO2 |
| Molecular Weight | 184.02 g/mol |
| Exact Mass | 182.99 |
| IUPAC Name | (2,2-dichlorocyclopropyl)methyl carbamate |
| SMILES | NC(=O)OCC1CC1(Cl)Cl |
| InChI | InChI=1S/C5H7Cl2NO2/c6-5(7)1-3(5)2-10-4(8)9/h3H,1-2H2,(H2,8,9) |
| InChIKey | ZORPPYRHRHDPAF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.02 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|