C20H16Cl2FN3O2S — CID 26539160
[(1S)-2,2-dichlorocyclopropyl]methyl 2-[[5-(2-fluorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 26539160) has the molecular formula C20H16Cl2FN3O2S and a molecular weight of 452.34 g/mol. Its IUPAC name is [(1S)-2,2-dichlorocyclopropyl]methyl 2-[[5-(2-fluorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | [(1S)-2,2-dichlorocyclopropyl]methyl 2-[[5-(2-fluorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 26539160 |
| Molecular Formula | C20H16Cl2FN3O2S |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | [(1S)-2,2-dichlorocyclopropyl]methyl 2-[[5-(2-fluorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | O=C(CSc1nnc(-c2ccccc2F)n1-c1ccccc1)OC[C@@H]1CC1(Cl)Cl |
| InChI | InChI=1S/C20H16Cl2FN3O2S/c21-20(22)10-13(20)11-28-17(27)12-29-19-25-24-18(15-8-4-5-9-16(15)23)26(19)14-6-2-1-3-7-14/h1-9,13H,10-12H2/t13-/m0/s1 |
| InChIKey | IJGOOISIHZAQAO-ZDUSSCGKSA-N |
| XLogP | 4.90 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|