C25H19FN4O3S — CID 30067194
2-(4-cyanophenoxy)ethyl 2-[[5-(2-fluorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 30067194) has the molecular formula C25H19FN4O3S and a molecular weight of 474.52 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)ethyl 2-[[5-(2-fluorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | 2-(4-cyanophenoxy)ethyl 2-[[5-(2-fluorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 30067194 |
| Molecular Formula | C25H19FN4O3S |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 2-(4-cyanophenoxy)ethyl 2-[[5-(2-fluorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | N#Cc1ccc(OCCOC(=O)CSc2nnc(-c3ccccc3F)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H19FN4O3S/c26-22-9-5-4-8-21(22)24-28-29-25(30(24)19-6-2-1-3-7-19)34-17-23(31)33-15-14-32-20-12-10-18(16-27)11-13-20/h1-13H,14-15,17H2 |
| InChIKey | SMJPLQJGPGAVSS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 90.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|