C10H18N7O6+ — CID 171119754
[(3aS,4R,10aS)-2,6-diamino-9,9,10,10-tetrahydroxy-3a,4,5,8-tetrahydro-1H-pyrrolo[1,2-c]purin-7-ium-4-yl]methyl carbamate (PubChem CID 171119754) has the molecular formula C10H18N7O6+ and a molecular weight of 332.30 g/mol. Its IUPAC name is [(3aS,4R,10aS)-2,6-diamino-9,9,10,10-tetrahydroxy-3a,4,5,8-tetrahydro-1H-pyrrolo[1,2-c]purin-7-ium-4-yl]methyl carbamate.
| Compound Name | [(3aS,4R,10aS)-2,6-diamino-9,9,10,10-tetrahydroxy-3a,4,5,8-tetrahydro-1H-pyrrolo[1,2-c]purin-7-ium-4-yl]methyl carbamate |
|---|---|
| PubChem CID | 171119754 |
| Molecular Formula | C10H18N7O6+ |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | [(3aS,4R,10aS)-2,6-diamino-9,9,10,10-tetrahydroxy-3a,4,5,8-tetrahydro-1H-pyrrolo[1,2-c]purin-7-ium-4-yl]methyl carbamate |
| SMILES | NC(=O)OC[C@@H]1NC(N)=[N+]2CC(O)(O)C(O)(O)[C@@]23NC(N)=N[C@@H]13 |
| InChI | InChI=1S/C10H17N7O6/c11-5-15-4-3(1-23-7(13)18)14-6(12)17-2-8(19,20)10(21,22)9(4,17)16-5/h3-4,19-22H,1-2H2,(H7,11,12,13,14,15,16,18)/p+1/t3-,4-,9-/m0/s1 |
| InChIKey | YBDMVZPVLTZOQU-GWWBTZNMSA-O |
| XLogP | -6.26 |
| TPSA | 224.71 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | -6.26 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|