C10H19N7O5+2 — CID 100935337
[(3aS,4R,10aS)-2,6-diamino-10,10-dihydroxy-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purine-3,7-diium-4-yl]methyl N-hydroxycarbamate (PubChem CID 100935337) has the molecular formula C10H19N7O5+2 and a molecular weight of 317.31 g/mol. Its IUPAC name is [(3aS,4R,10aS)-2,6-diamino-10,10-dihydroxy-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purine-3,7-diium-4-yl]methyl N-hydroxycarbamate.
| Compound Name | [(3aS,4R,10aS)-2,6-diamino-10,10-dihydroxy-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purine-3,7-diium-4-yl]methyl N-hydroxycarbamate |
|---|---|
| PubChem CID | 100935337 |
| Molecular Formula | C10H19N7O5+2 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | [(3aS,4R,10aS)-2,6-diamino-10,10-dihydroxy-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purine-3,7-diium-4-yl]methyl N-hydroxycarbamate |
| SMILES | NC1=[NH+][C@H]2[C@H](COC(=O)NO)NC(N)=[N+]3CCC(O)(O)[C@]23N1 |
| InChI | InChI=1S/C10H17N7O5/c11-6-14-5-4(3-22-8(18)16-21)13-7(12)17-2-1-9(19,20)10(5,17)15-6/h4-5,19-20H,1-3H2,(H7,11,12,13,14,15,16,18,21)/p+2/t4-,5-,10-/m0/s1 |
| InChIKey | QJRRNOYCFNRXNV-HGRQIUPRSA-P |
| XLogP | -6.45 |
| TPSA | 192.10 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | -6.45 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|