C13H24N6O3 — CID 176545851
(4R,9R,10S)-2,6-diamino-9-ethoxy-10-ethyl-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-3H-pyrrolo[1,2-c]purin-10-ol (PubChem CID 176545851) has the molecular formula C13H24N6O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is (4R,9R,10S)-2,6-diamino-9-ethoxy-10-ethyl-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-3H-pyrrolo[1,2-c]purin-10-ol.
| Compound Name | (4R,9R,10S)-2,6-diamino-9-ethoxy-10-ethyl-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-3H-pyrrolo[1,2-c]purin-10-ol |
|---|---|
| PubChem CID | 176545851 |
| Molecular Formula | C13H24N6O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | (4R,9R,10S)-2,6-diamino-9-ethoxy-10-ethyl-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-3H-pyrrolo[1,2-c]purin-10-ol |
| SMILES | CCO[C@@H]1CN2C(N)=N[C@@H](CO)C3NC(N)=NC32[C@@]1(O)CC |
| InChI | InChI=1S/C13H24N6O3/c1-3-12(21)8(22-4-2)5-19-11(15)16-7(6-20)9-13(12,19)18-10(14)17-9/h7-9,20-21H,3-6H2,1-2H3,(H2,15,16)(H3,14,17,18)/t7-,8+,9?,12+,13?/m0/s1 |
| InChIKey | AMTQAGVVWCLALU-FJMSROHMSA-N |
| XLogP | -2.48 |
| TPSA | 141.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |