C12H24N6O4 — CID 118442664
(4R,9S)-2,6-diamino-9-ethoxy-4-(methoxymethyl)-2,3,3a,4,8,9-hexahydro-1H-pyrrolo[1,2-c]purine-10,10-diol (PubChem CID 118442664) has the molecular formula C12H24N6O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is (4R,9S)-2,6-diamino-9-ethoxy-4-(methoxymethyl)-2,3,3a,4,8,9-hexahydro-1H-pyrrolo[1,2-c]purine-10,10-diol.
| Compound Name | (4R,9S)-2,6-diamino-9-ethoxy-4-(methoxymethyl)-2,3,3a,4,8,9-hexahydro-1H-pyrrolo[1,2-c]purine-10,10-diol |
|---|---|
| PubChem CID | 118442664 |
| Molecular Formula | C12H24N6O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | (4R,9S)-2,6-diamino-9-ethoxy-4-(methoxymethyl)-2,3,3a,4,8,9-hexahydro-1H-pyrrolo[1,2-c]purine-10,10-diol |
| SMILES | CCO[C@H]1CN2C(N)=N[C@@H](COC)C3NC(N)NC32C1(O)O |
| InChI | InChI=1S/C12H24N6O4/c1-3-22-7-4-18-10(14)15-6(5-21-2)8-11(18,12(7,19)20)17-9(13)16-8/h6-9,16-17,19-20H,3-5,13H2,1-2H3,(H2,14,15)/t6-,7-,8?,9?,11?/m0/s1 |
| InChIKey | LBBBJVJNKGPXLG-OHBYPKQFSA-N |
| XLogP | -3.77 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | -3.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|