C10H20N6O3+2 — CID 123957581
2,6-diamino-1-hydroxy-4-(hydroxymethyl)-10-methyl-3,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purine-1,7-diium-10-ol (PubChem CID 123957581) has the molecular formula C10H20N6O3+2 and a molecular weight of 272.31 g/mol. Its IUPAC name is 2,6-diamino-1-hydroxy-4-(hydroxymethyl)-10-methyl-3,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purine-1,7-diium-10-ol.
| Compound Name | 2,6-diamino-1-hydroxy-4-(hydroxymethyl)-10-methyl-3,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purine-1,7-diium-10-ol |
|---|---|
| PubChem CID | 123957581 |
| Molecular Formula | C10H20N6O3+2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 2,6-diamino-1-hydroxy-4-(hydroxymethyl)-10-methyl-3,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purine-1,7-diium-10-ol |
| SMILES | CC1(O)CC[N+]2=C(N)NC(CO)C3NC(N)=[N+](O)C321 |
| InChI | InChI=1S/C10H18N6O3/c1-9(18)2-3-15-7(11)13-5(4-17)6-10(9,15)16(19)8(12)14-6/h5-6,17-19H,2-4H2,1H3,(H4,11,12,13,14)/p+2 |
| InChIKey | CZRCGLMFYXNBLR-UHFFFAOYSA-P |
| XLogP | -4.18 |
| TPSA | 142.81 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | -4.18 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|