C25H24BrN — CID 143516126
5-bromo-2,3-dimethyl-1-(4-phenylphenyl)indole;prop-1-ene (PubChem CID 143516126) has the molecular formula C25H24BrN and a molecular weight of 418.38 g/mol. Its IUPAC name is 5-bromo-2,3-dimethyl-1-(4-phenylphenyl)indole;prop-1-ene.
| Compound Name | 5-bromo-2,3-dimethyl-1-(4-phenylphenyl)indole;prop-1-ene |
|---|---|
| PubChem CID | 143516126 |
| Molecular Formula | C25H24BrN |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 5-bromo-2,3-dimethyl-1-(4-phenylphenyl)indole;prop-1-ene |
| SMILES | C=CC.Cc1c(C)n(-c2ccc(-c3ccccc3)cc2)c2ccc(Br)cc12 |
| InChI | InChI=1S/C22H18BrN.C3H6/c1-15-16(2)24(22-13-10-19(23)14-21(15)22)20-11-8-18(9-12-20)17-6-4-3-5-7-17;1-3-2/h3-14H,1-2H3;3H,1H2,2H3 |
| InChIKey | VRBGKQBIZUEIFF-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|