C16H14BrN — CID 146003926
1-(3-bromophenyl)-2,3-dimethylindole (PubChem CID 146003926) has the molecular formula C16H14BrN and a molecular weight of 300.20 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2,3-dimethylindole.
| Compound Name | 1-(3-bromophenyl)-2,3-dimethylindole |
|---|---|
| PubChem CID | 146003926 |
| Molecular Formula | C16H14BrN |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 1-(3-bromophenyl)-2,3-dimethylindole |
| SMILES | Cc1c(C)n(-c2cccc(Br)c2)c2ccccc12 |
| InChI | InChI=1S/C16H14BrN/c1-11-12(2)18(14-7-5-6-13(17)10-14)16-9-4-3-8-15(11)16/h3-10H,1-2H3 |
| InChIKey | UUPQCDKFTGQFQH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |