C26H23BrN2 — CID 155244032
1-[2-bromo-3-(2,3-dimethylindol-1-yl)phenyl]-2,3-dimethylindole (PubChem CID 155244032) has the molecular formula C26H23BrN2 and a molecular weight of 443.39 g/mol. Its IUPAC name is 1-[2-bromo-3-(2,3-dimethylindol-1-yl)phenyl]-2,3-dimethylindole.
| Compound Name | 1-[2-bromo-3-(2,3-dimethylindol-1-yl)phenyl]-2,3-dimethylindole |
|---|---|
| PubChem CID | 155244032 |
| Molecular Formula | C26H23BrN2 |
| Molecular Weight | 443.39 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 1-[2-bromo-3-(2,3-dimethylindol-1-yl)phenyl]-2,3-dimethylindole |
| SMILES | Cc1c(C)n(-c2cccc(-n3c(C)c(C)c4ccccc43)c2Br)c2ccccc12 |
| InChI | InChI=1S/C26H23BrN2/c1-16-18(3)28(22-12-7-5-10-20(16)22)24-14-9-15-25(26(24)27)29-19(4)17(2)21-11-6-8-13-23(21)29/h5-15H,1-4H3 |
| InChIKey | GNCYJJJMDAVTIE-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.39 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |