C32H27BrCl4N2 — CID 165025513
1-bromo-2,3-dichlorobenzene;1-(2,3-dichlorophenyl)-2,3-dimethylindole;2,3-dimethyl-1H-indole (PubChem CID 165025513) has the molecular formula C32H27BrCl4N2 and a molecular weight of 661.30 g/mol. Its IUPAC name is 1-bromo-2,3-dichlorobenzene;1-(2,3-dichlorophenyl)-2,3-dimethylindole;2,3-dimethyl-1H-indole.
| Compound Name | 1-bromo-2,3-dichlorobenzene;1-(2,3-dichlorophenyl)-2,3-dimethylindole;2,3-dimethyl-1H-indole |
|---|---|
| PubChem CID | 165025513 |
| Molecular Formula | C32H27BrCl4N2 |
| Molecular Weight | 661.30 g/mol |
| Exact Mass | 658.01 |
| IUPAC Name | 1-bromo-2,3-dichlorobenzene;1-(2,3-dichlorophenyl)-2,3-dimethylindole;2,3-dimethyl-1H-indole |
| SMILES | Cc1[nH]c2ccccc2c1C.Cc1c(C)n(-c2cccc(Cl)c2Cl)c2ccccc12.Clc1cccc(Br)c1Cl |
| InChI | InChI=1S/C16H13Cl2N.C10H11N.C6H3BrCl2/c1-10-11(2)19(14-8-4-3-6-12(10)14)15-9-5-7-13(17)16(15)18;1-7-8(2)11-10-6-4-3-5-9(7)10;7-4-2-1-3-5(8)6(4)9/h3-9H,1-2H3;3-6,11H,1-2H3;1-3H |
| InChIKey | LVBVEVYOZQEPOD-UHFFFAOYSA-N |
| XLogP | 12.09 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.30 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|