C14H20N2O3 — CID 143517349
butane;5-ethyl-2-methyl-3H-pyrano[2,3-d]pyrimidine-4,7-dione (PubChem CID 143517349) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is butane;5-ethyl-2-methyl-3H-pyrano[2,3-d]pyrimidine-4,7-dione.
| Compound Name | butane;5-ethyl-2-methyl-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 143517349 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | butane;5-ethyl-2-methyl-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
| SMILES | CCCC.CCc1cc(=O)oc2nc(C)[nH]c(=O)c12 |
| InChI | InChI=1S/C10H10N2O3.C4H10/c1-3-6-4-7(13)15-10-8(6)9(14)11-5(2)12-10;1-3-4-2/h4H,3H2,1-2H3,(H,11,12,14);3-4H2,1-2H3 |
| InChIKey | DHFWFSYZWDXKFM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |