C27H28F7NO4 — CID 143517550
1-fluoro-4-methylbenzene;methyl 6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2,7-dimethyl-3-oxo-5,6,7,8-tetrahydro-1H-pyrrolizine-2-carboxylate (PubChem CID 143517550) has the molecular formula C27H28F7NO4 and a molecular weight of 563.51 g/mol. Its IUPAC name is 1-fluoro-4-methylbenzene;methyl 6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2,7-dimethyl-3-oxo-5,6,7,8-tetrahydro-1H-pyrrolizine-2-carboxylate.
| Compound Name | 1-fluoro-4-methylbenzene;methyl 6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2,7-dimethyl-3-oxo-5,6,7,8-tetrahydro-1H-pyrrolizine-2-carboxylate |
|---|---|
| PubChem CID | 143517550 |
| Molecular Formula | C27H28F7NO4 |
| Molecular Weight | 563.51 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | 1-fluoro-4-methylbenzene;methyl 6-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2,7-dimethyl-3-oxo-5,6,7,8-tetrahydro-1H-pyrrolizine-2-carboxylate |
| SMILES | COC(=O)C1(C)CC2C(C)C(OCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)CN2C1=O.Cc1ccc(F)cc1 |
| InChI | InChI=1S/C20H21F6NO4.C7H7F/c1-10-14-7-18(2,17(29)30-3)16(28)27(14)8-15(10)31-9-11-4-12(19(21,22)23)6-13(5-11)20(24,25)26;1-6-2-4-7(8)5-3-6/h4-6,10,14-15H,7-9H2,1-3H3;2-5H,1H3 |
| InChIKey | QTLUGJKHAQIGBG-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.51 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|