About N-methyl-4-(1,3-oxazol-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine
N-methyl-4-(1,3-oxazol-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine (PubChem CID 143518004) has the molecular formula C14H10F3N3OS
and a molecular weight of 325.32 g/mol. Its IUPAC name is N-methyl-4-(1,3-oxazol-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N-methyl-4-(1,3-oxazol-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine |
| PubChem CID | 143518004 |
| Molecular Formula | C14H10F3N3OS |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | N-methyl-4-(1,3-oxazol-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine |
| SMILES | CNc1nc(-c2ncco2)c(-c2cccc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C14H10F3N3OS/c1-18-13-20-10(12-19-5-6-21-12)11(22-13)8-3-2-4-9(7-8)14(15,16)17/h2-7H,1H3,(H,18,20) |
| InChIKey | RSLZONYXCGIIGO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-4-(1,3-oxazol-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-4-(1,3-oxazol-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine?
The IUPAC name of N-methyl-4-(1,3-oxazol-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine (CID 143518004) is N-methyl-4-(1,3-oxazol-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine.
What is the SMILES notation for N-methyl-4-(1,3-oxazol-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine?
The canonical SMILES for N-methyl-4-(1,3-oxazol-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine is CNc1nc(-c2ncco2)c(-c2cccc(C(F)(F)F)c2)s1.
What is the InChIKey of N-methyl-4-(1,3-oxazol-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine?
The InChIKey is RSLZONYXCGIIGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F3N3OS/c1-18-13-20-10(12-19-5-6-21-12)11(22-13)8-3-2-4-9(7-8)14(15,16)17/h2-7H,1H3,(H,18,20).
What are the key properties of N-methyl-4-(1,3-oxazol-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine?
N-methyl-4-(1,3-oxazol-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine has a molecular weight of 325.32 g/mol, XLogP of 4.53, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-4-(1,3-oxazol-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine is sourced from PubChem (CID 143518004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).