C15H23INO+ — CID 143518807
[5-(2,6-dimethylmorpholin-4-yl)-2-propan-2-ylphenyl]iodanium (PubChem CID 143518807) has the molecular formula C15H23INO+ and a molecular weight of 360.26 g/mol. Its IUPAC name is [5-(2,6-dimethylmorpholin-4-yl)-2-propan-2-ylphenyl]iodanium.
| Compound Name | [5-(2,6-dimethylmorpholin-4-yl)-2-propan-2-ylphenyl]iodanium |
|---|---|
| PubChem CID | 143518807 |
| Molecular Formula | C15H23INO+ |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | [5-(2,6-dimethylmorpholin-4-yl)-2-propan-2-ylphenyl]iodanium |
| SMILES | CC1CN(c2ccc(C(C)C)c([IH+])c2)CC(C)O1 |
| InChI | InChI=1S/C15H23INO/c1-10(2)14-6-5-13(7-15(14)16)17-8-11(3)18-12(4)9-17/h5-7,10-12,16H,8-9H2,1-4H3/q+1 |
| InChIKey | RKVZOXJEXPYZEC-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|