About 1-aminoethyl 6-methyl-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-5-oxoheptanoate;ethane
1-aminoethyl 6-methyl-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-5-oxoheptanoate;ethane (PubChem CID 143519615) has the molecular formula C18H37NO5
and a molecular weight of 347.50 g/mol. Its IUPAC name is 1-aminoethyl 6-methyl-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-5-oxoheptanoate;ethane.
Molecular Properties
| Compound Name | 1-aminoethyl 6-methyl-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-5-oxoheptanoate;ethane |
| PubChem CID | 143519615 |
| Molecular Formula | C18H37NO5 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.27 |
| IUPAC Name | 1-aminoethyl 6-methyl-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-5-oxoheptanoate;ethane |
| SMILES | CC.CC(N)OC(=O)CCCC(=O)C(C)(C)OCCOC(C)(C)C |
| InChI | InChI=1S/C16H31NO5.C2H6/c1-12(17)22-14(19)9-7-8-13(18)16(5,6)21-11-10-20-15(2,3)4;1-2/h12H,7-11,17H2,1-6H3;1-2H3 |
| InChIKey | DNCBUYBRZLHEJP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-aminoethyl 6-methyl-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-5-oxoheptanoate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoethyl 6-methyl-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-5-oxoheptanoate;ethane?
The IUPAC name of 1-aminoethyl 6-methyl-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-5-oxoheptanoate;ethane (CID 143519615) is 1-aminoethyl 6-methyl-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-5-oxoheptanoate;ethane.
What is the SMILES notation for 1-aminoethyl 6-methyl-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-5-oxoheptanoate;ethane?
The canonical SMILES for 1-aminoethyl 6-methyl-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-5-oxoheptanoate;ethane is CC.CC(N)OC(=O)CCCC(=O)C(C)(C)OCCOC(C)(C)C.
What is the InChIKey of 1-aminoethyl 6-methyl-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-5-oxoheptanoate;ethane?
The InChIKey is DNCBUYBRZLHEJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31NO5.C2H6/c1-12(17)22-14(19)9-7-8-13(18)16(5,6)21-11-10-20-15(2,3)4;1-2/h12H,7-11,17H2,1-6H3;1-2H3.
What are the key properties of 1-aminoethyl 6-methyl-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-5-oxoheptanoate;ethane?
1-aminoethyl 6-methyl-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-5-oxoheptanoate;ethane has a molecular weight of 347.50 g/mol, XLogP of 3.21, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoethyl 6-methyl-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-5-oxoheptanoate;ethane is sourced from PubChem (CID 143519615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).