About 2-(3,4-dimethoxyphenyl)-1-[4-[3-(4-methylphenyl)sulfanylpropyl]piperidin-1-yl]ethanone
2-(3,4-dimethoxyphenyl)-1-[4-[3-(4-methylphenyl)sulfanylpropyl]piperidin-1-yl]ethanone (PubChem CID 143519645) has the molecular formula C25H33NO3S
and a molecular weight of 427.61 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1-[4-[3-(4-methylphenyl)sulfanylpropyl]piperidin-1-yl]ethanone.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxyphenyl)-1-[4-[3-(4-methylphenyl)sulfanylpropyl]piperidin-1-yl]ethanone |
| PubChem CID | 143519645 |
| Molecular Formula | C25H33NO3S |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1-[4-[3-(4-methylphenyl)sulfanylpropyl]piperidin-1-yl]ethanone |
| SMILES | COc1ccc(CC(=O)N2CCC(CCCSc3ccc(C)cc3)CC2)cc1OC |
| InChI | InChI=1S/C25H33NO3S/c1-19-6-9-22(10-7-19)30-16-4-5-20-12-14-26(15-13-20)25(27)18-21-8-11-23(28-2)24(17-21)29-3/h6-11,17,20H,4-5,12-16,18H2,1-3H3 |
| InChIKey | INPUYIVSNNJJIQ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,4-dimethoxyphenyl)-1-[4-[3-(4-methylphenyl)sulfanylpropyl]piperidin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxyphenyl)-1-[4-[3-(4-methylphenyl)sulfanylpropyl]piperidin-1-yl]ethanone?
The IUPAC name of 2-(3,4-dimethoxyphenyl)-1-[4-[3-(4-methylphenyl)sulfanylpropyl]piperidin-1-yl]ethanone (CID 143519645) is 2-(3,4-dimethoxyphenyl)-1-[4-[3-(4-methylphenyl)sulfanylpropyl]piperidin-1-yl]ethanone.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)-1-[4-[3-(4-methylphenyl)sulfanylpropyl]piperidin-1-yl]ethanone?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)-1-[4-[3-(4-methylphenyl)sulfanylpropyl]piperidin-1-yl]ethanone is COc1ccc(CC(=O)N2CCC(CCCSc3ccc(C)cc3)CC2)cc1OC.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)-1-[4-[3-(4-methylphenyl)sulfanylpropyl]piperidin-1-yl]ethanone?
The InChIKey is INPUYIVSNNJJIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H33NO3S/c1-19-6-9-22(10-7-19)30-16-4-5-20-12-14-26(15-13-20)25(27)18-21-8-11-23(28-2)24(17-21)29-3/h6-11,17,20H,4-5,12-16,18H2,1-3H3.
What are the key properties of 2-(3,4-dimethoxyphenyl)-1-[4-[3-(4-methylphenyl)sulfanylpropyl]piperidin-1-yl]ethanone?
2-(3,4-dimethoxyphenyl)-1-[4-[3-(4-methylphenyl)sulfanylpropyl]piperidin-1-yl]ethanone has a molecular weight of 427.61 g/mol, XLogP of 5.37, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)-1-[4-[3-(4-methylphenyl)sulfanylpropyl]piperidin-1-yl]ethanone is sourced from PubChem (CID 143519645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).