About 4-[1-[2-(3,5-dichlorophenyl)-3-pyridinyl]propan-2-yl]benzonitrile
4-[1-[2-(3,5-dichlorophenyl)-3-pyridinyl]propan-2-yl]benzonitrile (PubChem CID 143520419) has the molecular formula C21H16Cl2N2
and a molecular weight of 367.28 g/mol. Its IUPAC name is 4-[1-[2-(3,5-dichlorophenyl)-3-pyridinyl]propan-2-yl]benzonitrile.
Molecular Properties
| Compound Name | 4-[1-[2-(3,5-dichlorophenyl)-3-pyridinyl]propan-2-yl]benzonitrile |
| PubChem CID | 143520419 |
| Molecular Formula | C21H16Cl2N2 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 4-[1-[2-(3,5-dichlorophenyl)-3-pyridinyl]propan-2-yl]benzonitrile |
| SMILES | CC(Cc1cccnc1-c1cc(Cl)cc(Cl)c1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C21H16Cl2N2/c1-14(16-6-4-15(13-24)5-7-16)9-17-3-2-8-25-21(17)18-10-19(22)12-20(23)11-18/h2-8,10-12,14H,9H2,1H3 |
| InChIKey | HQGVQJBIPXYZNQ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[1-[2-(3,5-dichlorophenyl)-3-pyridinyl]propan-2-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[2-(3,5-dichlorophenyl)-3-pyridinyl]propan-2-yl]benzonitrile?
The IUPAC name of 4-[1-[2-(3,5-dichlorophenyl)-3-pyridinyl]propan-2-yl]benzonitrile (CID 143520419) is 4-[1-[2-(3,5-dichlorophenyl)-3-pyridinyl]propan-2-yl]benzonitrile.
What is the SMILES notation for 4-[1-[2-(3,5-dichlorophenyl)-3-pyridinyl]propan-2-yl]benzonitrile?
The canonical SMILES for 4-[1-[2-(3,5-dichlorophenyl)-3-pyridinyl]propan-2-yl]benzonitrile is CC(Cc1cccnc1-c1cc(Cl)cc(Cl)c1)c1ccc(C#N)cc1.
What is the InChIKey of 4-[1-[2-(3,5-dichlorophenyl)-3-pyridinyl]propan-2-yl]benzonitrile?
The InChIKey is HQGVQJBIPXYZNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16Cl2N2/c1-14(16-6-4-15(13-24)5-7-16)9-17-3-2-8-25-21(17)18-10-19(22)12-20(23)11-18/h2-8,10-12,14H,9H2,1H3.
What are the key properties of 4-[1-[2-(3,5-dichlorophenyl)-3-pyridinyl]propan-2-yl]benzonitrile?
4-[1-[2-(3,5-dichlorophenyl)-3-pyridinyl]propan-2-yl]benzonitrile has a molecular weight of 367.28 g/mol, XLogP of 6.27, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[2-(3,5-dichlorophenyl)-3-pyridinyl]propan-2-yl]benzonitrile is sourced from PubChem (CID 143520419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).