C28H30F4N2O6 — CID 143521548
1-[6-fluoro-2-methoxy-3-methyl-4-[(E)-2-[[2-methyl-4-(trifluoromethoxy)phenyl]methylcarbamoyl]but-2-enoyl]phenyl]piperidine-4-carboxylic acid (PubChem CID 143521548) has the molecular formula C28H30F4N2O6 and a molecular weight of 566.55 g/mol. Its IUPAC name is 1-[6-fluoro-2-methoxy-3-methyl-4-[(E)-2-[[2-methyl-4-(trifluoromethoxy)phenyl]methylcarbamoyl]but-2-enoyl]phenyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[6-fluoro-2-methoxy-3-methyl-4-[(E)-2-[[2-methyl-4-(trifluoromethoxy)phenyl]methylcarbamoyl]but-2-enoyl]phenyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 143521548 |
| Molecular Formula | C28H30F4N2O6 |
| Molecular Weight | 566.55 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | 1-[6-fluoro-2-methoxy-3-methyl-4-[(E)-2-[[2-methyl-4-(trifluoromethoxy)phenyl]methylcarbamoyl]but-2-enoyl]phenyl]piperidine-4-carboxylic acid |
| SMILES | C/C=C(/C(=O)NCc1ccc(OC(F)(F)F)cc1C)C(=O)c1cc(F)c(N2CCC(C(=O)O)CC2)c(OC)c1C |
| InChI | InChI=1S/C28H30F4N2O6/c1-5-20(26(36)33-14-18-6-7-19(12-15(18)2)40-28(30,31)32)24(35)21-13-22(29)23(25(39-4)16(21)3)34-10-8-17(9-11-34)27(37)38/h5-7,12-13,17H,8-11,14H2,1-4H3,(H,33,36)(H,37,38)/b20-5+ |
| InChIKey | JANIHFODCNRUOU-DENHBWNVSA-N |
| XLogP | 5.10 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.55 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|