C23H26NO3+ — CID 143521937
benzyl-[(2Z,4E,6E)-7-(2,4,6-trimethoxyphenyl)hepta-2,4,6-trienylidene]azanium (PubChem CID 143521937) has the molecular formula C23H26NO3+ and a molecular weight of 364.47 g/mol. Its IUPAC name is benzyl-[(2Z,4E,6E)-7-(2,4,6-trimethoxyphenyl)hepta-2,4,6-trienylidene]azanium.
| Compound Name | benzyl-[(2Z,4E,6E)-7-(2,4,6-trimethoxyphenyl)hepta-2,4,6-trienylidene]azanium |
|---|---|
| PubChem CID | 143521937 |
| Molecular Formula | C23H26NO3+ |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | benzyl-[(2Z,4E,6E)-7-(2,4,6-trimethoxyphenyl)hepta-2,4,6-trienylidene]azanium |
| SMILES | COc1cc(OC)c(/C=C/C=C/C=C\C=[NH+]\Cc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C23H25NO3/c1-25-20-16-22(26-2)21(23(17-20)27-3)14-10-5-4-6-11-15-24-18-19-12-8-7-9-13-19/h4-17H,18H2,1-3H3/p+1/b5-4+,11-6-,14-10+,24-15+ |
| InChIKey | NHODHSJJVUIACL-XFJHFQSDSA-O |
| XLogP | 3.19 |
| TPSA | 41.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|