C24H42N4O2 — CID 143522216
4-amino-N-cyclohexyl-3-methoxybenzamide;1-(cyclopropylmethyl)piperazine;ethane (PubChem CID 143522216) has the molecular formula C24H42N4O2 and a molecular weight of 418.63 g/mol. Its IUPAC name is 4-amino-N-cyclohexyl-3-methoxybenzamide;1-(cyclopropylmethyl)piperazine;ethane.
| Compound Name | 4-amino-N-cyclohexyl-3-methoxybenzamide;1-(cyclopropylmethyl)piperazine;ethane |
|---|---|
| PubChem CID | 143522216 |
| Molecular Formula | C24H42N4O2 |
| Molecular Weight | 418.63 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | 4-amino-N-cyclohexyl-3-methoxybenzamide;1-(cyclopropylmethyl)piperazine;ethane |
| SMILES | C1CN(CC2CC2)CCN1.CC.COc1cc(C(=O)NC2CCCCC2)ccc1N |
| InChI | InChI=1S/C14H20N2O2.C8H16N2.C2H6/c1-18-13-9-10(7-8-12(13)15)14(17)16-11-5-3-2-4-6-11;1-2-8(1)7-10-5-3-9-4-6-10;1-2/h7-9,11H,2-6,15H2,1H3,(H,16,17);8-9H,1-7H2;1-2H3 |
| InChIKey | MHJOOQVLSOPQFH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.63 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|