C21H32N4O4 — CID 77400335
cyclopentyl 2-amino-4-[3-[(4-amino-3-methoxybenzoyl)amino]pyrrolidin-1-yl]butanoate (PubChem CID 77400335) has the molecular formula C21H32N4O4 and a molecular weight of 404.51 g/mol. Its IUPAC name is cyclopentyl 2-amino-4-[3-[(4-amino-3-methoxybenzoyl)amino]pyrrolidin-1-yl]butanoate.
| Compound Name | cyclopentyl 2-amino-4-[3-[(4-amino-3-methoxybenzoyl)amino]pyrrolidin-1-yl]butanoate |
|---|---|
| PubChem CID | 77400335 |
| Molecular Formula | C21H32N4O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | cyclopentyl 2-amino-4-[3-[(4-amino-3-methoxybenzoyl)amino]pyrrolidin-1-yl]butanoate |
| SMILES | COc1cc(C(=O)NC2CCN(CCC(N)C(=O)OC3CCCC3)C2)ccc1N |
| InChI | InChI=1S/C21H32N4O4/c1-28-19-12-14(6-7-17(19)22)20(26)24-15-8-10-25(13-15)11-9-18(23)21(27)29-16-4-2-3-5-16/h6-7,12,15-16,18H,2-5,8-11,13,22-23H2,1H3,(H,24,26) |
| InChIKey | YDSFDEHHFVKQEA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 119.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|