About propane;propan-2-yl N-[(E)-3-amino-2-methylbut-1-enyl]ethanimidate
propane;propan-2-yl N-[(E)-3-amino-2-methylbut-1-enyl]ethanimidate (PubChem CID 143522817) has the molecular formula C13H28N2O
and a molecular weight of 228.38 g/mol. Its IUPAC name is propane;propan-2-yl N-[(E)-3-amino-2-methylbut-1-enyl]ethanimidate.
Molecular Properties
| Compound Name | propane;propan-2-yl N-[(E)-3-amino-2-methylbut-1-enyl]ethanimidate |
| PubChem CID | 143522817 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | propane;propan-2-yl N-[(E)-3-amino-2-methylbut-1-enyl]ethanimidate |
| SMILES | C/C(=C\N=C(/C)OC(C)C)C(C)N.CCC |
| InChI | InChI=1S/C10H20N2O.C3H8/c1-7(2)13-10(5)12-6-8(3)9(4)11;1-3-2/h6-7,9H,11H2,1-5H3;3H2,1-2H3/b8-6+,12-10+; |
| InChIKey | LDOWZDJMGHIKET-OWOLJXCDSA-N |
| XLogP | 3.50 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze propane;propan-2-yl N-[(E)-3-amino-2-methylbut-1-enyl]ethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;propan-2-yl N-[(E)-3-amino-2-methylbut-1-enyl]ethanimidate?
The IUPAC name of propane;propan-2-yl N-[(E)-3-amino-2-methylbut-1-enyl]ethanimidate (CID 143522817) is propane;propan-2-yl N-[(E)-3-amino-2-methylbut-1-enyl]ethanimidate.
What is the SMILES notation for propane;propan-2-yl N-[(E)-3-amino-2-methylbut-1-enyl]ethanimidate?
The canonical SMILES for propane;propan-2-yl N-[(E)-3-amino-2-methylbut-1-enyl]ethanimidate is C/C(=C\N=C(/C)OC(C)C)C(C)N.CCC.
What is the InChIKey of propane;propan-2-yl N-[(E)-3-amino-2-methylbut-1-enyl]ethanimidate?
The InChIKey is LDOWZDJMGHIKET-OWOLJXCDSA-N. The full InChI is InChI=1S/C10H20N2O.C3H8/c1-7(2)13-10(5)12-6-8(3)9(4)11;1-3-2/h6-7,9H,11H2,1-5H3;3H2,1-2H3/b8-6+,12-10+;.
What are the key properties of propane;propan-2-yl N-[(E)-3-amino-2-methylbut-1-enyl]ethanimidate?
propane;propan-2-yl N-[(E)-3-amino-2-methylbut-1-enyl]ethanimidate has a molecular weight of 228.38 g/mol, XLogP of 3.50, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propane;propan-2-yl N-[(E)-3-amino-2-methylbut-1-enyl]ethanimidate is sourced from PubChem (CID 143522817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).