C40H43N3O6 — CID 143526739
(2,4-dibenzylpiperazin-1-yl)-[2-(4-ethoxyphenyl)-1-(3-hydroxy-2-methoxyphenyl)-5-methylpyrrol-3-yl]methanone;formic acid (PubChem CID 143526739) has the molecular formula C40H43N3O6 and a molecular weight of 661.80 g/mol. Its IUPAC name is (2,4-dibenzylpiperazin-1-yl)-[2-(4-ethoxyphenyl)-1-(3-hydroxy-2-methoxyphenyl)-5-methylpyrrol-3-yl]methanone;formic acid.
| Compound Name | (2,4-dibenzylpiperazin-1-yl)-[2-(4-ethoxyphenyl)-1-(3-hydroxy-2-methoxyphenyl)-5-methylpyrrol-3-yl]methanone;formic acid |
|---|---|
| PubChem CID | 143526739 |
| Molecular Formula | C40H43N3O6 |
| Molecular Weight | 661.80 g/mol |
| Exact Mass | 661.32 |
| IUPAC Name | (2,4-dibenzylpiperazin-1-yl)-[2-(4-ethoxyphenyl)-1-(3-hydroxy-2-methoxyphenyl)-5-methylpyrrol-3-yl]methanone;formic acid |
| SMILES | CCOc1ccc(-c2c(C(=O)N3CCN(Cc4ccccc4)CC3Cc3ccccc3)cc(C)n2-c2cccc(O)c2OC)cc1.O=CO |
| InChI | InChI=1S/C39H41N3O4.CH2O2/c1-4-46-33-20-18-31(19-21-33)37-34(24-28(2)42(37)35-16-11-17-36(43)38(35)45-3)39(44)41-23-22-40(26-30-14-9-6-10-15-30)27-32(41)25-29-12-7-5-8-13-29;2-1-3/h5-21,24,32,43H,4,22-23,25-27H2,1-3H3;1H,(H,2,3) |
| InChIKey | RHKPYKVAPJZDBJ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 104.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.80 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|