C37H34F3N3O4S — CID 86641760
[4-[[4-benzyl-1-(5-methyl-1,2-diphenylpyrrole-3-carbonyl)piperazin-2-yl]methyl]phenyl] trifluoromethanesulfonate (PubChem CID 86641760) has the molecular formula C37H34F3N3O4S and a molecular weight of 673.76 g/mol. Its IUPAC name is [4-[[4-benzyl-1-(5-methyl-1,2-diphenylpyrrole-3-carbonyl)piperazin-2-yl]methyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[[4-benzyl-1-(5-methyl-1,2-diphenylpyrrole-3-carbonyl)piperazin-2-yl]methyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86641760 |
| Molecular Formula | C37H34F3N3O4S |
| Molecular Weight | 673.76 g/mol |
| Exact Mass | 673.22 |
| IUPAC Name | [4-[[4-benzyl-1-(5-methyl-1,2-diphenylpyrrole-3-carbonyl)piperazin-2-yl]methyl]phenyl] trifluoromethanesulfonate |
| SMILES | Cc1cc(C(=O)N2CCN(Cc3ccccc3)CC2Cc2ccc(OS(=O)(=O)C(F)(F)F)cc2)c(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C37H34F3N3O4S/c1-27-23-34(35(30-13-7-3-8-14-30)43(27)31-15-9-4-10-16-31)36(44)42-22-21-41(25-29-11-5-2-6-12-29)26-32(42)24-28-17-19-33(20-18-28)47-48(45,46)37(38,39)40/h2-20,23,32H,21-22,24-26H2,1H3 |
| InChIKey | ISASDSWKVNXXFG-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.76 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|