C42H45N3O4 — CID 90789591
[4-[[4-benzyl-1-(5-methyl-1,2-diphenylpyrrole-3-carbonyl)piperazin-2-yl]methyl]phenyl] 3,3-dimethylbutaneperoxoate (PubChem CID 90789591) has the molecular formula C42H45N3O4 and a molecular weight of 655.84 g/mol. Its IUPAC name is [4-[[4-benzyl-1-(5-methyl-1,2-diphenylpyrrole-3-carbonyl)piperazin-2-yl]methyl]phenyl] 3,3-dimethylbutaneperoxoate.
| Compound Name | [4-[[4-benzyl-1-(5-methyl-1,2-diphenylpyrrole-3-carbonyl)piperazin-2-yl]methyl]phenyl] 3,3-dimethylbutaneperoxoate |
|---|---|
| PubChem CID | 90789591 |
| Molecular Formula | C42H45N3O4 |
| Molecular Weight | 655.84 g/mol |
| Exact Mass | 655.34 |
| IUPAC Name | [4-[[4-benzyl-1-(5-methyl-1,2-diphenylpyrrole-3-carbonyl)piperazin-2-yl]methyl]phenyl] 3,3-dimethylbutaneperoxoate |
| SMILES | Cc1cc(C(=O)N2CCN(Cc3ccccc3)CC2Cc2ccc(OOC(=O)CC(C)(C)C)cc2)c(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C42H45N3O4/c1-31-26-38(40(34-16-10-6-11-17-34)45(31)35-18-12-7-13-19-35)41(47)44-25-24-43(29-33-14-8-5-9-15-33)30-36(44)27-32-20-22-37(23-21-32)48-49-39(46)28-42(2,3)4/h5-23,26,36H,24-25,27-30H2,1-4H3 |
| InChIKey | NIFCVSFDQLBASO-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.84 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|